C12H12N4 — CID 153358506
7-ethyl-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 153358506) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 7-ethyl-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | 7-ethyl-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 153358506 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 7-ethyl-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | CCc1ccc2c(c1)[nH]c1c(N)ncnc12 |
| InChI | InChI=1S/C12H12N4/c1-2-7-3-4-8-9(5-7)16-11-10(8)14-6-15-12(11)13/h3-6,16H,2H2,1H3,(H2,13,14,15) |
| InChIKey | FKBNDRWTIYVTHJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |