C23H29ClN5O8PS — CID 153359039
[(1R)-1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid (PubChem CID 153359039) has the molecular formula C23H29ClN5O8PS and a molecular weight of 602.01 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid |
|---|---|
| PubChem CID | 153359039 |
| Molecular Formula | C23H29ClN5O8PS |
| Molecular Weight | 602.01 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | [(1R)-1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Cc1ccccc1)S(=O)(=O)C[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H29ClN5O8PS/c24-23-27-20(26-14-8-4-5-9-14)15-11-25-29(21(15)28-23)22-19(31)18(30)16(37-22)12-39(35,36)17(38(32,33)34)10-13-6-2-1-3-7-13/h1-3,6-7,11,14,16-19,22,30-31H,4-5,8-10,12H2,(H,26,27,28)(H2,32,33,34)/t16-,17?,18-,19-,22-/m1/s1 |
| InChIKey | TXGGTRQBPNWULT-AZVOGJBZSA-N |
| XLogP | 1.61 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.01 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|