C10H14N2 — CID 153359253
ethane;3-methyl-3aH-pyrrolo[2,3-b]pyridine (PubChem CID 153359253) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is ethane;3-methyl-3aH-pyrrolo[2,3-b]pyridine.
| Compound Name | ethane;3-methyl-3aH-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 153359253 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethane;3-methyl-3aH-pyrrolo[2,3-b]pyridine |
| SMILES | CC.CC1=CN=C2N=CC=CC12 |
| InChI | InChI=1S/C8H8N2.C2H6/c1-6-5-10-8-7(6)3-2-4-9-8;1-2/h2-5,7H,1H3;1-2H3 |
| InChIKey | PRBNOWVGIDAXGU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |