C9H10N2 — CID 153359267
4-methyl-2,4a-dihydro-1,8-naphthyridine (PubChem CID 153359267) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-methyl-2,4a-dihydro-1,8-naphthyridine.
| Compound Name | 4-methyl-2,4a-dihydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 153359267 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4-methyl-2,4a-dihydro-1,8-naphthyridine |
| SMILES | CC1=CCN=C2N=CC=CC12 |
| InChI | InChI=1S/C9H10N2/c1-7-4-6-11-9-8(7)3-2-5-10-9/h2-5,8H,6H2,1H3 |
| InChIKey | YXZJDNWYMPDGTO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|