About methylideneruthenium(1+);phenyl(phenyl)diazene
methylideneruthenium(1+);phenyl(phenyl)diazene (PubChem CID 153361952) has the molecular formula C13H11N2Ru
and a molecular weight of 296.32 g/mol. Its IUPAC name is methylideneruthenium(1+);phenyl(phenyl)diazene.
Molecular Properties
| Compound Name | methylideneruthenium(1+);phenyl(phenyl)diazene |
| PubChem CID | 153361952 |
| Molecular Formula | C13H11N2Ru |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | methylideneruthenium(1+);phenyl(phenyl)diazene |
| SMILES | C=[Ru+].[c-]1ccccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C12H9N2.CH2.Ru/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;;/h1-9H;1H2;/q-1;;+1/b14-13+;; |
| InChIKey | WJNAQYLNLCQSCX-QDBORUFSSA-N |
| XLogP | 3.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methylideneruthenium(1+);phenyl(phenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylideneruthenium(1+);phenyl(phenyl)diazene?
The IUPAC name of methylideneruthenium(1+);phenyl(phenyl)diazene (CID 153361952) is methylideneruthenium(1+);phenyl(phenyl)diazene.
What is the SMILES notation for methylideneruthenium(1+);phenyl(phenyl)diazene?
The canonical SMILES for methylideneruthenium(1+);phenyl(phenyl)diazene is C=[Ru+].[c-]1ccccc1/N=N/c1ccccc1.
What is the InChIKey of methylideneruthenium(1+);phenyl(phenyl)diazene?
The InChIKey is WJNAQYLNLCQSCX-QDBORUFSSA-N. The full InChI is InChI=1S/C12H9N2.CH2.Ru/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;;/h1-9H;1H2;/q-1;;+1/b14-13+;;.
What are the key properties of methylideneruthenium(1+);phenyl(phenyl)diazene?
methylideneruthenium(1+);phenyl(phenyl)diazene has a molecular weight of 296.32 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylideneruthenium(1+);phenyl(phenyl)diazene is sourced from PubChem (CID 153361952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).