About methyl(phenyl)diazene;platinum;uranium
methyl(phenyl)diazene;platinum;uranium (PubChem CID 155655293) has the molecular formula C7H7N2PtU-
and a molecular weight of 552.25 g/mol. Its IUPAC name is methyl(phenyl)diazene;platinum;uranium.
Molecular Properties
| Compound Name | methyl(phenyl)diazene;platinum;uranium |
| PubChem CID | 155655293 |
| Molecular Formula | C7H7N2PtU- |
| Molecular Weight | 552.25 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | methyl(phenyl)diazene;platinum;uranium |
| SMILES | C/N=N/c1[c-]cccc1.[Pt].[U] |
| InChI | InChI=1S/C7H7N2.Pt.U/c1-8-9-7-5-3-2-4-6-7;;/h2-5H,1H3;;/q-1;;/b9-8+;; |
| InChIKey | RIYQMBYMTCPNNI-YEUQMBKVSA-N |
| XLogP | 2.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 552.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl(phenyl)diazene;platinum;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(phenyl)diazene;platinum;uranium?
The IUPAC name of methyl(phenyl)diazene;platinum;uranium (CID 155655293) is methyl(phenyl)diazene;platinum;uranium.
What is the SMILES notation for methyl(phenyl)diazene;platinum;uranium?
The canonical SMILES for methyl(phenyl)diazene;platinum;uranium is C/N=N/c1[c-]cccc1.[Pt].[U].
What is the InChIKey of methyl(phenyl)diazene;platinum;uranium?
The InChIKey is RIYQMBYMTCPNNI-YEUQMBKVSA-N. The full InChI is InChI=1S/C7H7N2.Pt.U/c1-8-9-7-5-3-2-4-6-7;;/h2-5H,1H3;;/q-1;;/b9-8+;;.
What are the key properties of methyl(phenyl)diazene;platinum;uranium?
methyl(phenyl)diazene;platinum;uranium has a molecular weight of 552.25 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(phenyl)diazene;platinum;uranium is sourced from PubChem (CID 155655293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).