C24H42O9 — CID 153363330
(Z)-but-2-ene;ethane;1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate (PubChem CID 153363330) has the molecular formula C24H42O9 and a molecular weight of 474.59 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate.
| Compound Name | (Z)-but-2-ene;ethane;1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate |
|---|---|
| PubChem CID | 153363330 |
| Molecular Formula | C24H42O9 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (Z)-but-2-ene;ethane;1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate |
| SMILES | C/C=C\C.CC.CCC(=CCOCCOCCOCCOCC=C1COC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C18H28O9.C4H8.C2H6/c1-3-16(26-15(2)19)4-6-21-8-10-23-12-13-24-11-9-22-7-5-17-14-25-18(20)27-17;1-3-4-2;1-2/h4-5H,3,6-14H2,1-2H3;3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | DVUMMYHRYUUNNG-LWFKIUJUSA-N |
| XLogP | 4.57 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|