C12H9Cl4F3N6 — CID 153366797
N-amino-N-[[1-(3-chloro-2-pyridinyl)-5-(trichloromethyl)pyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide (PubChem CID 153366797) has the molecular formula C12H9Cl4F3N6 and a molecular weight of 436.05 g/mol. Its IUPAC name is N-amino-N-[[1-(3-chloro-2-pyridinyl)-5-(trichloromethyl)pyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N-amino-N-[[1-(3-chloro-2-pyridinyl)-5-(trichloromethyl)pyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 153366797 |
| Molecular Formula | C12H9Cl4F3N6 |
| Molecular Weight | 436.05 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | N-amino-N-[[1-(3-chloro-2-pyridinyl)-5-(trichloromethyl)pyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide |
| SMILES | [H]/N=C(/N(N)Cc1cc(C(Cl)(Cl)Cl)n(-c2ncccc2Cl)n1)C(F)(F)F |
| InChI | InChI=1S/C12H9Cl4F3N6/c13-7-2-1-3-22-9(7)25-8(11(14,15)16)4-6(23-25)5-24(21)10(20)12(17,18)19/h1-4,20H,5,21H2/b20-10+ |
| InChIKey | OXDIVJCTPNDTAN-KEBDBYFISA-N |
| XLogP | 3.96 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.05 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|