C13H31N3 — CID 153372136
ethane;ethene;(Z)-1-N'-ethyl-4,4-dimethylpent-2-ene-1,1,3-triamine (PubChem CID 153372136) has the molecular formula C13H31N3 and a molecular weight of 229.41 g/mol. Its IUPAC name is ethane;ethene;(Z)-1-N'-ethyl-4,4-dimethylpent-2-ene-1,1,3-triamine.
| Compound Name | ethane;ethene;(Z)-1-N'-ethyl-4,4-dimethylpent-2-ene-1,1,3-triamine |
|---|---|
| PubChem CID | 153372136 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | ethane;ethene;(Z)-1-N'-ethyl-4,4-dimethylpent-2-ene-1,1,3-triamine |
| SMILES | C=C.CC.CCNC(N)/C=C(\N)C(C)(C)C |
| InChI | InChI=1S/C9H21N3.C2H6.C2H4/c1-5-12-8(11)6-7(10)9(2,3)4;2*1-2/h6,8,12H,5,10-11H2,1-4H3;1-2H3;1-2H2/b7-6-;; |
| InChIKey | UGXCICZYOMJQMO-AQTVDGORSA-N |
| XLogP | 2.60 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|