C11H15F2N3 — CID 153373622
3-(3,3-difluoro-4-methylpiperazin-1-yl)aniline (PubChem CID 153373622) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-(3,3-difluoro-4-methylpiperazin-1-yl)aniline.
| Compound Name | 3-(3,3-difluoro-4-methylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 153373622 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-(3,3-difluoro-4-methylpiperazin-1-yl)aniline |
| SMILES | CN1CCN(c2cccc(N)c2)CC1(F)F |
| InChI | InChI=1S/C11H15F2N3/c1-15-5-6-16(8-11(15,12)13)10-4-2-3-9(14)7-10/h2-4,7H,5-6,8,14H2,1H3 |
| InChIKey | GEYZHUJZXSVTCA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|