C34H58O7 — CID 153375560
(9E,11E,13E)-3-hydroxy-4-methoxy-15-[2-(2-methoxyethoxy)ethoxy]-2,6,8,14-tetramethyl-16-(5,6,6-trimethyloxan-2-yl)hexadeca-1,9,11,13-tetraen-5-one (PubChem CID 153375560) has the molecular formula C34H58O7 and a molecular weight of 578.83 g/mol. Its IUPAC name is (9E,11E,13E)-3-hydroxy-4-methoxy-15-[2-(2-methoxyethoxy)ethoxy]-2,6,8,14-tetramethyl-16-(5,6,6-trimethyloxan-2-yl)hexadeca-1,9,11,13-tetraen-5-one.
| Compound Name | (9E,11E,13E)-3-hydroxy-4-methoxy-15-[2-(2-methoxyethoxy)ethoxy]-2,6,8,14-tetramethyl-16-(5,6,6-trimethyloxan-2-yl)hexadeca-1,9,11,13-tetraen-5-one |
|---|---|
| PubChem CID | 153375560 |
| Molecular Formula | C34H58O7 |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | (9E,11E,13E)-3-hydroxy-4-methoxy-15-[2-(2-methoxyethoxy)ethoxy]-2,6,8,14-tetramethyl-16-(5,6,6-trimethyloxan-2-yl)hexadeca-1,9,11,13-tetraen-5-one |
| SMILES | C=C(C)C(O)C(OC)C(=O)C(C)CC(C)/C=C/C=C/C=C(\C)C(CC1CCC(C)C(C)(C)O1)OCCOCCOC |
| InChI | InChI=1S/C34H58O7/c1-24(2)31(35)33(38-10)32(36)27(5)22-25(3)14-12-11-13-15-26(4)30(40-21-20-39-19-18-37-9)23-29-17-16-28(6)34(7,8)41-29/h11-15,25,27-31,33,35H,1,16-23H2,2-10H3/b13-11+,14-12+,26-15+ |
| InChIKey | ZYORZRKGABQZGN-OYGDHZKUSA-N |
| XLogP | 6.26 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|