C19H34AuN5O3PS+ — CID 153376137
CID 153376137 (PubChem CID 153376137) has the molecular formula C19H34AuN5O3PS+ and a molecular weight of 640.52 g/mol.
| Compound Name | CID 153376137 |
|---|---|
| PubChem CID | 153376137 |
| Molecular Formula | C19H34AuN5O3PS+ |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | — |
| SMILES | CC[PH+](CC)CC.O=C(O)CCCCC1SCC2NC(=O)N(Cc3[c-]nn[nH]3)C21.[Au+] |
| InChI | InChI=1S/C13H18N5O3S.C6H15P.Au/c19-11(20)4-2-1-3-10-12-9(7-22-10)15-13(21)18(12)6-8-5-14-17-16-8;1-4-7(5-2)6-3;/h9-10,12H,1-4,6-7H2,(H,15,21)(H,19,20)(H,14,16,17);4-6H2,1-3H3;/q-1;;+1/p+1 |
| InChIKey | PQDCREHPUUMMCI-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|