C15H27NO — CID 153379124
butanamide;propane;1,3-xylene (PubChem CID 153379124) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is butanamide;propane;1,3-xylene.
| Compound Name | butanamide;propane;1,3-xylene |
|---|---|
| PubChem CID | 153379124 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | butanamide;propane;1,3-xylene |
| SMILES | CCC.CCCC(N)=O.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C4H9NO.C3H8/c1-7-4-3-5-8(2)6-7;1-2-3-4(5)6;1-3-2/h3-6H,1-2H3;2-3H2,1H3,(H2,5,6);3H2,1-2H3 |
| InChIKey | FHIUNYKIOHKCGQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |