C8H7ClN2S2 — CID 153382972
6-chloro-2-ethylsulfanyl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 153382972) has the molecular formula C8H7ClN2S2 and a molecular weight of 230.75 g/mol. Its IUPAC name is 6-chloro-2-ethylsulfanyl-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 6-chloro-2-ethylsulfanyl-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 153382972 |
| Molecular Formula | C8H7ClN2S2 |
| Molecular Weight | 230.75 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 6-chloro-2-ethylsulfanyl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CCSc1nc2cnc(Cl)cc2s1 |
| InChI | InChI=1S/C8H7ClN2S2/c1-2-12-8-11-5-4-10-7(9)3-6(5)13-8/h3-4H,2H2,1H3 |
| InChIKey | LRBRQMYPUDWRFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.75 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|