C11H12ClNOS2 — CID 19806340
6-chloro-2-(2-ethoxyethylsulfanyl)-1,3-benzothiazole (PubChem CID 19806340) has the molecular formula C11H12ClNOS2 and a molecular weight of 273.81 g/mol. Its IUPAC name is 6-chloro-2-(2-ethoxyethylsulfanyl)-1,3-benzothiazole.
| Compound Name | 6-chloro-2-(2-ethoxyethylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 19806340 |
| Molecular Formula | C11H12ClNOS2 |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 6-chloro-2-(2-ethoxyethylsulfanyl)-1,3-benzothiazole |
| SMILES | CCOCCSc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C11H12ClNOS2/c1-2-14-5-6-15-11-13-9-4-3-8(12)7-10(9)16-11/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | MUWUITRLZNESKD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|