C27H34N6O3 — CID 153384152
(E)-2-N-[6-ethoxy-2-[3-(3-morpholin-4-ylpropoxy)phenyl]quinazolin-4-yl]-1-iminobut-2-ene-2,3-diamine (PubChem CID 153384152) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is (E)-2-N-[6-ethoxy-2-[3-(3-morpholin-4-ylpropoxy)phenyl]quinazolin-4-yl]-1-iminobut-2-ene-2,3-diamine.
| Compound Name | (E)-2-N-[6-ethoxy-2-[3-(3-morpholin-4-ylpropoxy)phenyl]quinazolin-4-yl]-1-iminobut-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 153384152 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (E)-2-N-[6-ethoxy-2-[3-(3-morpholin-4-ylpropoxy)phenyl]quinazolin-4-yl]-1-iminobut-2-ene-2,3-diamine |
| SMILES | [H]/N=C/C(Nc1nc(-c2cccc(OCCCN3CCOCC3)c2)nc2ccc(OCC)cc12)=C(/C)N |
| InChI | InChI=1S/C27H34N6O3/c1-3-35-22-8-9-24-23(17-22)27(31-25(18-28)19(2)29)32-26(30-24)20-6-4-7-21(16-20)36-13-5-10-33-11-14-34-15-12-33/h4,6-9,16-18,28H,3,5,10-15,29H2,1-2H3,(H,30,31,32)/b25-19+,28-18+ |
| InChIKey | KKZBINKGYYPVEE-IJZWQZBYSA-N |
| XLogP | 4.05 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|