About [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate
[5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate (PubChem CID 153384474) has the molecular formula C23H28F2N2O3
and a molecular weight of 418.48 g/mol. Its IUPAC name is [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate.
Molecular Properties
| Compound Name | [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate |
| PubChem CID | 153384474 |
| Molecular Formula | C23H28F2N2O3 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate |
| SMILES | CC(CC(c1ccc(F)cc1)c1ccc(F)cc1)C(C)(O)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C23H28F2N2O3/c1-16(23(2,29)30-22(28)27-13-11-26-12-14-27)15-21(17-3-7-19(24)8-4-17)18-5-9-20(25)10-6-18/h3-10,16,21,26,29H,11-15H2,1-2H3 |
| InChIKey | LDHDEFYNBARHDL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate?
The IUPAC name of [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate (CID 153384474) is [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate.
What is the SMILES notation for [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate?
The canonical SMILES for [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate is CC(CC(c1ccc(F)cc1)c1ccc(F)cc1)C(C)(O)OC(=O)N1CCNCC1.
What is the InChIKey of [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate?
The InChIKey is LDHDEFYNBARHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28F2N2O3/c1-16(23(2,29)30-22(28)27-13-11-26-12-14-27)15-21(17-3-7-19(24)8-4-17)18-5-9-20(25)10-6-18/h3-10,16,21,26,29H,11-15H2,1-2H3.
What are the key properties of [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate?
[5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate has a molecular weight of 418.48 g/mol, XLogP of 3.87, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate is sourced from PubChem (CID 153384474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).