C23H28F2N2O3 — CID 153384474
[5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate (PubChem CID 153384474) has the molecular formula C23H28F2N2O3 and a molecular weight of 418.48 g/mol. Its IUPAC name is [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate.
| Compound Name | [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153384474 |
| Molecular Formula | C23H28F2N2O3 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [5,5-bis(4-fluorophenyl)-2-hydroxy-3-methylpentan-2-yl] piperazine-1-carboxylate |
| SMILES | CC(CC(c1ccc(F)cc1)c1ccc(F)cc1)C(C)(O)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C23H28F2N2O3/c1-16(23(2,29)30-22(28)27-13-11-26-12-14-27)15-21(17-3-7-19(24)8-4-17)18-5-9-20(25)10-6-18/h3-10,16,21,26,29H,11-15H2,1-2H3 |
| InChIKey | LDHDEFYNBARHDL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|