C21H16N4O3S2 — CID 153385996
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(1-benzothiophen-3-yl)thiadiazole-5-carboxamide (PubChem CID 153385996) has the molecular formula C21H16N4O3S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(1-benzothiophen-3-yl)thiadiazole-5-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(1-benzothiophen-3-yl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 153385996 |
| Molecular Formula | C21H16N4O3S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-(1-benzothiophen-3-yl)thiadiazole-5-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1snnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C21H16N4O3S2/c22-20(27)18(26)15(10-12-6-2-1-3-7-12)23-21(28)19-17(24-25-30-19)14-11-29-16-9-5-4-8-13(14)16/h1-9,11,15H,10H2,(H2,22,27)(H,23,28) |
| InChIKey | ZKPCJUPRYISQFW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|