C20H16ClN3O3S — CID 142753746
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-5-phenyl-1,2-thiazole-4-carboxamide (PubChem CID 142753746) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-5-phenyl-1,2-thiazole-4-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-5-phenyl-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142753746 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-chloro-5-phenyl-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1c(Cl)nsc1-c1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O3S/c21-18-15(17(28-24-18)13-9-5-2-6-10-13)20(27)23-14(16(25)19(22)26)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H2,22,26)(H,23,27)/t14-/m0/s1 |
| InChIKey | MOOOKPOCJGTRPL-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|