C18H14F4N2O3 — CID 153386297
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-fluoro-6-(trifluoromethyl)benzamide (PubChem CID 153386297) has the molecular formula C18H14F4N2O3 and a molecular weight of 382.31 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-fluoro-6-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-fluoro-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 153386297 |
| Molecular Formula | C18H14F4N2O3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-fluoro-6-(trifluoromethyl)benzamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C18H14F4N2O3/c19-12-8-4-7-11(18(20,21)22)14(12)17(27)24-13(15(25)16(23)26)9-10-5-2-1-3-6-10/h1-8,13H,9H2,(H2,23,26)(H,24,27)/t13-/m0/s1 |
| InChIKey | RHZFLCKBTDJJPN-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|