C21H27N7O2 — CID 153387263
(11S)-2-[(2-ethyl-5-methyl-1,5-dihydropyrazole-3-carbonyl)amino]-9-methyl-11-prop-2-enyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide (PubChem CID 153387263) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is (11S)-2-[(2-ethyl-5-methyl-1,5-dihydropyrazole-3-carbonyl)amino]-9-methyl-11-prop-2-enyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide.
| Compound Name | (11S)-2-[(2-ethyl-5-methyl-1,5-dihydropyrazole-3-carbonyl)amino]-9-methyl-11-prop-2-enyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 153387263 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (11S)-2-[(2-ethyl-5-methyl-1,5-dihydropyrazole-3-carbonyl)amino]-9-methyl-11-prop-2-enyl-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
| SMILES | C=CC[C@H]1CN(C)c2cc(C(N)=O)cc3nc(NC(=O)C4=CC(C)NN4CC)n1c23 |
| InChI | InChI=1S/C21H27N7O2/c1-5-7-14-11-26(4)16-10-13(19(22)29)9-15-18(16)28(14)21(23-15)24-20(30)17-8-12(3)25-27(17)6-2/h5,8-10,12,14,25H,1,6-7,11H2,2-4H3,(H2,22,29)(H,23,24,30)/t12?,14-/m0/s1 |
| InChIKey | ZIRLEIBRCZROLJ-PYMCNQPYSA-N |
| XLogP | 1.75 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|