C36H46N6O7 — CID 153389074
[butanoyl(formyl)amino] 4-[[3-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-2,3-dimethylbutan-2-yl]amino]-4-oxobutanoate (PubChem CID 153389074) has the molecular formula C36H46N6O7 and a molecular weight of 674.80 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 4-[[3-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-2,3-dimethylbutan-2-yl]amino]-4-oxobutanoate.
| Compound Name | [butanoyl(formyl)amino] 4-[[3-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-2,3-dimethylbutan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 153389074 |
| Molecular Formula | C36H46N6O7 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | [butanoyl(formyl)amino] 4-[[3-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-2,3-dimethylbutan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCCCc1nc2c(N)nc3cc(C(C)(C)C(C)(C)NC(=O)CCC(=O)ON(C=O)C(=O)CCC)ccc3c2n1Cc1cc(O)ccc1O |
| InChI | InChI=1S/C36H46N6O7/c1-7-9-11-28-39-32-33(41(28)20-22-18-24(44)13-15-27(22)45)25-14-12-23(19-26(25)38-34(32)37)35(3,4)36(5,6)40-29(46)16-17-31(48)49-42(21-43)30(47)10-8-2/h12-15,18-19,21,44-45H,7-11,16-17,20H2,1-6H3,(H2,37,38)(H,40,46) |
| InChIKey | YMAFCONPBGWZGM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 189.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|