C23H20F3N5O2 — CID 153389428
3-(3-formamido-1H-pyrrolo[2,3-b]pyridin-4-yl)benzamide;N-methyl-4-(trifluoromethyl)aniline (PubChem CID 153389428) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is 3-(3-formamido-1H-pyrrolo[2,3-b]pyridin-4-yl)benzamide;N-methyl-4-(trifluoromethyl)aniline.
| Compound Name | 3-(3-formamido-1H-pyrrolo[2,3-b]pyridin-4-yl)benzamide;N-methyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 153389428 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-(3-formamido-1H-pyrrolo[2,3-b]pyridin-4-yl)benzamide;N-methyl-4-(trifluoromethyl)aniline |
| SMILES | CNc1ccc(C(F)(F)F)cc1.NC(=O)c1cccc(-c2ccnc3[nH]cc(NC=O)c23)c1 |
| InChI | InChI=1S/C15H12N4O2.C8H8F3N/c16-14(21)10-3-1-2-9(6-10)11-4-5-17-15-13(11)12(7-18-15)19-8-20;1-12-7-4-2-6(3-5-7)8(9,10)11/h1-8H,(H2,16,21)(H,17,18)(H,19,20);2-5,12H,1H3 |
| InChIKey | IFXYKEGXCVBDTB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|