C24H23F3N4O2 — CID 153389441
formamide;2-[3-[3-[4-(trifluoromethyl)anilino]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propan-2-ol (PubChem CID 153389441) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is formamide;2-[3-[3-[4-(trifluoromethyl)anilino]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propan-2-ol.
| Compound Name | formamide;2-[3-[3-[4-(trifluoromethyl)anilino]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 153389441 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | formamide;2-[3-[3-[4-(trifluoromethyl)anilino]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cccc(-c2cnc3[nH]cc(Nc4ccc(C(F)(F)F)cc4)c3c2)c1.NC=O |
| InChI | InChI=1S/C23H20F3N3O.CH3NO/c1-22(2,30)17-5-3-4-14(10-17)15-11-19-20(13-28-21(19)27-12-15)29-18-8-6-16(7-9-18)23(24,25)26;2-1-3/h3-13,29-30H,1-2H3,(H,27,28);1H,(H2,2,3) |
| InChIKey | XUMVNJXNFHXHOG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|