C11H17KN2 — CID 153392290
potassium;ethane;3-ethenyl-N,5-dimethyl-4H-pyridin-4-id-2-amine (PubChem CID 153392290) has the molecular formula C11H17KN2 and a molecular weight of 216.37 g/mol. Its IUPAC name is potassium;ethane;3-ethenyl-N,5-dimethyl-4H-pyridin-4-id-2-amine.
| Compound Name | potassium;ethane;3-ethenyl-N,5-dimethyl-4H-pyridin-4-id-2-amine |
|---|---|
| PubChem CID | 153392290 |
| Molecular Formula | C11H17KN2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | potassium;ethane;3-ethenyl-N,5-dimethyl-4H-pyridin-4-id-2-amine |
| SMILES | C=Cc1[c-]c(C)cnc1NC.CC.[K+] |
| InChI | InChI=1S/C9H11N2.C2H6.K/c1-4-8-5-7(2)6-11-9(8)10-3;1-2;/h4,6H,1H2,2-3H3,(H,10,11);1-2H3;/q-1;;+1 |
| InChIKey | HBYRVVJNQNLYDH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|