C35H49B2FN2O8S2 — CID 153394750
1-(cyclopropylmethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole;ethane;7-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 153394750) has the molecular formula C35H49B2FN2O8S2 and a molecular weight of 730.54 g/mol. Its IUPAC name is 1-(cyclopropylmethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole;ethane;7-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(cyclopropylmethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole;ethane;7-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 153394750 |
| Molecular Formula | C35H49B2FN2O8S2 |
| Molecular Weight | 730.54 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | 1-(cyclopropylmethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole;ethane;7-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC.CC1(C)OB(c2ccc(F)c3c2ccn3S(C)(=O)=O)OC1(C)C.CC1(C)OB(c2cccc3c2ccn3S(=O)(=O)CC2CC2)OC1(C)C |
| InChI | InChI=1S/C18H24BNO4S.C15H19BFNO4S.C2H6/c1-17(2)18(3,4)24-19(23-17)15-6-5-7-16-14(15)10-11-20(16)25(21,22)12-13-8-9-13;1-14(2)15(3,4)22-16(21-14)11-6-7-12(17)13-10(11)8-9-18(13)23(5,19)20;1-2/h5-7,10-11,13H,8-9,12H2,1-4H3;6-9H,1-5H3;1-2H3 |
| InChIKey | DRIJARLWDGOFKM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 115.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|