C15H21ClN6O2S — CID 153396614
2-[(6-chloro-2-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]-N-methylethanesulfonamide (PubChem CID 153396614) has the molecular formula C15H21ClN6O2S and a molecular weight of 384.89 g/mol. Its IUPAC name is 2-[(6-chloro-2-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(6-chloro-2-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 153396614 |
| Molecular Formula | C15H21ClN6O2S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[(6-chloro-2-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1nc(C2CCNCC2)nc2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H21ClN6O2S/c1-17-25(23,24)7-6-19-15-11-8-13(16)20-9-12(11)21-14(22-15)10-2-4-18-5-3-10/h8-10,17-18H,2-7H2,1H3,(H,19,21,22) |
| InChIKey | JPOFVQRGQLFJIL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|