C21H26ClN7O2S — CID 146309259
2-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(3-methylphenyl)ethanesulfonamide (PubChem CID 146309259) has the molecular formula C21H26ClN7O2S and a molecular weight of 476.01 g/mol. Its IUPAC name is 2-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(3-methylphenyl)ethanesulfonamide.
| Compound Name | 2-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(3-methylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 146309259 |
| Molecular Formula | C21H26ClN7O2S |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 2-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(3-methylphenyl)ethanesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)CCNc2nc(N3CCN(C)CC3)nc3cnc(Cl)cc23)c1 |
| InChI | InChI=1S/C21H26ClN7O2S/c1-15-4-3-5-16(12-15)27-32(30,31)11-6-23-20-17-13-19(22)24-14-18(17)25-21(26-20)29-9-7-28(2)8-10-29/h3-5,12-14,27H,6-11H2,1-2H3,(H,23,25,26) |
| InChIKey | OWCBGVWCYKLKLO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|