C17H19ClN6O — CID 146350557
6-chloro-N-(furan-2-ylmethyl)-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146350557) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is 6-chloro-N-(furan-2-ylmethyl)-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(furan-2-ylmethyl)-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146350557 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 6-chloro-N-(furan-2-ylmethyl)-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CN1CCN(c2nc(NCc3ccco3)c3cc(Cl)ncc3n2)CC1 |
| InChI | InChI=1S/C17H19ClN6O/c1-23-4-6-24(7-5-23)17-21-14-11-19-15(18)9-13(14)16(22-17)20-10-12-3-2-8-25-12/h2-3,8-9,11H,4-7,10H2,1H3,(H,20,21,22) |
| InChIKey | ZQBRMMQQDNSPEV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|