About 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine
6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146350677) has the molecular formula C16H16ClIN6O
and a molecular weight of 470.70 g/mol. Its IUPAC name is 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
| PubChem CID | 146350677 |
| Molecular Formula | C16H16ClIN6O |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Clc1cc2c(NCc3ccco3)nc(N3CCN(I)CC3)nc2cn1 |
| InChI | InChI=1S/C16H16ClIN6O/c17-14-8-12-13(10-19-14)21-16(23-3-5-24(18)6-4-23)22-15(12)20-9-11-2-1-7-25-11/h1-2,7-8,10H,3-6,9H2,(H,20,21,22) |
| InChIKey | DWDMWNDJOLNSAF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine?
The IUPAC name of 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine (CID 146350677) is 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine is Clc1cc2c(NCc3ccco3)nc(N3CCN(I)CC3)nc2cn1.
What is the InChIKey of 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine?
The InChIKey is DWDMWNDJOLNSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClIN6O/c17-14-8-12-13(10-19-14)21-16(23-3-5-24(18)6-4-23)22-15(12)20-9-11-2-1-7-25-11/h1-2,7-8,10H,3-6,9H2,(H,20,21,22).
What are the key properties of 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine?
6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine has a molecular weight of 470.70 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 146350677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).