C16H16ClIN6O — CID 146350677
6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146350677) has the molecular formula C16H16ClIN6O and a molecular weight of 470.70 g/mol. Its IUPAC name is 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146350677 |
| Molecular Formula | C16H16ClIN6O |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 6-chloro-N-(furan-2-ylmethyl)-2-(4-iodopiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Clc1cc2c(NCc3ccco3)nc(N3CCN(I)CC3)nc2cn1 |
| InChI | InChI=1S/C16H16ClIN6O/c17-14-8-12-13(10-19-14)21-16(23-3-5-24(18)6-4-23)22-15(12)20-9-11-2-1-7-25-11/h1-2,7-8,10H,3-6,9H2,(H,20,21,22) |
| InChIKey | DWDMWNDJOLNSAF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|