C20H23ClN6O2S — CID 146309391
N-[2-(benzenesulfonyl)ethyl]-6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146309391) has the molecular formula C20H23ClN6O2S and a molecular weight of 446.96 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146309391 |
| Molecular Formula | C20H23ClN6O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CN1CCN(c2nc(NCCS(=O)(=O)c3ccccc3)c3cc(Cl)ncc3n2)CC1 |
| InChI | InChI=1S/C20H23ClN6O2S/c1-26-8-10-27(11-9-26)20-24-17-14-23-18(21)13-16(17)19(25-20)22-7-12-30(28,29)15-5-3-2-4-6-15/h2-6,13-14H,7-12H2,1H3,(H,22,24,25) |
| InChIKey | BGMFCTWRCBWHRH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|