C20H23Cl2N7O2S — CID 175992984
1-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(4-chlorophenyl)ethanesulfonamide (PubChem CID 175992984) has the molecular formula C20H23Cl2N7O2S and a molecular weight of 496.42 g/mol. Its IUPAC name is 1-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(4-chlorophenyl)ethanesulfonamide.
| Compound Name | 1-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(4-chlorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 175992984 |
| Molecular Formula | C20H23Cl2N7O2S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 1-[[6-chloro-2-(4-methylpiperazin-1-yl)pyrido[3,4-d]pyrimidin-4-yl]amino]-N-(4-chlorophenyl)ethanesulfonamide |
| SMILES | CC(Nc1nc(N2CCN(C)CC2)nc2cnc(Cl)cc12)S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23Cl2N7O2S/c1-13(32(30,31)27-15-5-3-14(21)4-6-15)24-19-16-11-18(22)23-12-17(16)25-20(26-19)29-9-7-28(2)8-10-29/h3-6,11-13,27H,7-10H2,1-2H3,(H,24,25,26) |
| InChIKey | MKLHMOIIMJKQSJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|