C18H21ClN6S — CID 146350496
6-chloro-2-(4-methylpiperazin-1-yl)-N-[(3-methylthiophen-2-yl)methyl]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146350496) has the molecular formula C18H21ClN6S and a molecular weight of 388.93 g/mol. Its IUPAC name is 6-chloro-2-(4-methylpiperazin-1-yl)-N-[(3-methylthiophen-2-yl)methyl]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-[(3-methylthiophen-2-yl)methyl]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146350496 |
| Molecular Formula | C18H21ClN6S |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-[(3-methylthiophen-2-yl)methyl]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1ccsc1CNc1nc(N2CCN(C)CC2)nc2cnc(Cl)cc12 |
| InChI | InChI=1S/C18H21ClN6S/c1-12-3-8-26-15(12)11-21-17-13-9-16(19)20-10-14(13)22-18(23-17)25-6-4-24(2)5-7-25/h3,8-10H,4-7,11H2,1-2H3,(H,21,22,23) |
| InChIKey | LPUSNJLZZWFNPT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|