C20H20ClN7O — CID 146309252
3-[[(6-chloro-2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-1,3-dihydroindol-2-one (PubChem CID 146309252) has the molecular formula C20H20ClN7O and a molecular weight of 409.88 g/mol. Its IUPAC name is 3-[[(6-chloro-2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[[(6-chloro-2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 146309252 |
| Molecular Formula | C20H20ClN7O |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-[[(6-chloro-2-piperazin-1-ylpyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1CNc1nc(N2CCNCC2)nc2cnc(Cl)cc12 |
| InChI | InChI=1S/C20H20ClN7O/c21-17-9-13-16(11-23-17)26-20(28-7-5-22-6-8-28)27-18(13)24-10-14-12-3-1-2-4-15(12)25-19(14)29/h1-4,9,11,14,22H,5-8,10H2,(H,25,29)(H,24,26,27) |
| InChIKey | HREVUDYAMJXHIT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|