C15H29N3 — CID 153397406
(3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine (PubChem CID 153397406) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is (3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine.
| Compound Name | (3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 153397406 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine |
| SMILES | CC/C=C(\C=C(/CC)NC)N1CCCN(C)CC1 |
| InChI | InChI=1S/C15H29N3/c1-5-8-15(13-14(6-2)16-3)18-10-7-9-17(4)11-12-18/h8,13,16H,5-7,9-12H2,1-4H3/b14-13+,15-8+ |
| InChIKey | SKCZUPJJUUQDAN-RIJNBSGKSA-N |
| XLogP | 2.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|