C14H9F7N4O — CID 153404366
4-fluoro-5-[3-(1,1,2,3,3,3-hexafluoropropoxy)-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzonitrile (PubChem CID 153404366) has the molecular formula C14H9F7N4O and a molecular weight of 382.24 g/mol. Its IUPAC name is 4-fluoro-5-[3-(1,1,2,3,3,3-hexafluoropropoxy)-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzonitrile.
| Compound Name | 4-fluoro-5-[3-(1,1,2,3,3,3-hexafluoropropoxy)-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 153404366 |
| Molecular Formula | C14H9F7N4O |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-fluoro-5-[3-(1,1,2,3,3,3-hexafluoropropoxy)-5-methyl-1,2,4-triazol-1-yl]-2-methylbenzonitrile |
| SMILES | Cc1cc(F)c(-n2nc(OC(F)(F)C(F)C(F)(F)F)nc2C)cc1C#N |
| InChI | InChI=1S/C14H9F7N4O/c1-6-3-9(15)10(4-8(6)5-22)25-7(2)23-12(24-25)26-14(20,21)11(16)13(17,18)19/h3-4,11H,1-2H3 |
| InChIKey | QJPJMGVHDMLUGM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |