C18H15F12N5O3 — CID 161477899
3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbaldehyde;3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile (PubChem CID 161477899) has the molecular formula C18H15F12N5O3 and a molecular weight of 577.33 g/mol. Its IUPAC name is 3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbaldehyde;3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile.
| Compound Name | 3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbaldehyde;3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 161477899 |
| Molecular Formula | C18H15F12N5O3 |
| Molecular Weight | 577.33 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbaldehyde;3-(1,1,2,3,3,3-hexafluoropropoxy)-1,4-dimethylpyrazole-5-carbonitrile |
| SMILES | Cc1c(OC(F)(F)C(F)C(F)(F)F)nn(C)c1C#N.Cc1c(OC(F)(F)C(F)C(F)(F)F)nn(C)c1C=O |
| InChI | InChI=1S/C9H7F6N3O.C9H8F6N2O2/c1-4-5(3-16)18(2)17-6(4)19-9(14,15)7(10)8(11,12)13;1-4-5(3-18)17(2)16-6(4)19-9(14,15)7(10)8(11,12)13/h7H,1-2H3;3,7H,1-2H3 |
| InChIKey | WDYPTUVEHXXRDA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|