C20H15N3O4 — CID 153406591
N-[(E)-[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 153406591) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[(E)-[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(E)-[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 153406591 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[(E)-[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(N/N=C/c1cccc(-c2ccc3c(c2)OCO3)n1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H15N3O4/c24-16-7-4-13(5-8-16)20(25)23-21-11-15-2-1-3-17(22-15)14-6-9-18-19(10-14)27-12-26-18/h1-11,24H,12H2,(H,23,25)/b21-11+ |
| InChIKey | ALAZXLXELCSQCF-SRZZPIQSSA-N |
| XLogP | 2.95 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|