C10H8N6 — CID 153410208
2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 153410208) has the molecular formula C10H8N6 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 153410208 |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-pyrazin-2-ylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Nc1ccn2nc(-c3cnccn3)cc2n1 |
| InChI | InChI=1S/C10H8N6/c11-9-1-4-16-10(14-9)5-7(15-16)8-6-12-2-3-13-8/h1-6H,(H2,11,14) |
| InChIKey | MYAFPSIBUIWWPT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |