C11H6ClF2NO2 — CID 153410836
2-chloro-2-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carbonitrile (PubChem CID 153410836) has the molecular formula C11H6ClF2NO2 and a molecular weight of 257.62 g/mol. Its IUPAC name is 2-chloro-2-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carbonitrile.
| Compound Name | 2-chloro-2-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 153410836 |
| Molecular Formula | C11H6ClF2NO2 |
| Molecular Weight | 257.62 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-chloro-2-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carbonitrile |
| SMILES | N#CC1CC1(Cl)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C11H6ClF2NO2/c12-10(4-7(10)5-15)6-1-2-8-9(3-6)17-11(13,14)16-8/h1-3,7H,4H2 |
| InChIKey | QYRVCXIBJGQWEM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|