C18H24N4 — CID 153420870
N,N'-di(propan-2-yl)-1-pyrido[3,4-b]indol-9-ylmethanediamine (PubChem CID 153420870) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)-1-pyrido[3,4-b]indol-9-ylmethanediamine.
| Compound Name | N,N'-di(propan-2-yl)-1-pyrido[3,4-b]indol-9-ylmethanediamine |
|---|---|
| PubChem CID | 153420870 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N,N'-di(propan-2-yl)-1-pyrido[3,4-b]indol-9-ylmethanediamine |
| SMILES | CC(C)NC(NC(C)C)n1c2ccccc2c2ccncc21 |
| InChI | InChI=1S/C18H24N4/c1-12(2)20-18(21-13(3)4)22-16-8-6-5-7-14(16)15-9-10-19-11-17(15)22/h5-13,18,20-21H,1-4H3 |
| InChIKey | OUWLILDWDCYIJV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|