C17H15IrN3-2 — CID 153430365
1-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2H-benzimidazol-2-ide-4-carbonitrile;iridium (PubChem CID 153430365) has the molecular formula C17H15IrN3-2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2H-benzimidazol-2-ide-4-carbonitrile;iridium.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2H-benzimidazol-2-ide-4-carbonitrile;iridium |
|---|---|
| PubChem CID | 153430365 |
| Molecular Formula | C17H15IrN3-2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-3-methyl-2H-benzimidazol-2-ide-4-carbonitrile;iridium |
| SMILES | Cc1[c-]c(N2[CH-]N(C)c3c(C#N)cccc32)cc(C)c1.[Ir] |
| InChI | InChI=1S/C17H15N3.Ir/c1-12-7-13(2)9-15(8-12)20-11-19(3)17-14(10-18)5-4-6-16(17)20;/h4-8,11H,1-3H3;/q-2; |
| InChIKey | SIZFESGYTDTTRI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|