C11H7N7 — CID 67116562
2,3-bis(triazol-2-yl)benzonitrile (PubChem CID 67116562) has the molecular formula C11H7N7 and a molecular weight of 237.23 g/mol. Its IUPAC name is 2,3-bis(triazol-2-yl)benzonitrile.
| Compound Name | 2,3-bis(triazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 67116562 |
| Molecular Formula | C11H7N7 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2,3-bis(triazol-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-n2nccn2)c1-n1nccn1 |
| InChI | InChI=1S/C11H7N7/c12-8-9-2-1-3-10(17-13-4-5-14-17)11(9)18-15-6-7-16-18/h1-7H |
| InChIKey | UZVSODJADUXQLQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |