C33H22N4Se — CID 153436698
10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoselenazine (PubChem CID 153436698) has the molecular formula C33H22N4Se and a molecular weight of 553.53 g/mol. Its IUPAC name is 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoselenazine.
| Compound Name | 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoselenazine |
|---|---|
| PubChem CID | 153436698 |
| Molecular Formula | C33H22N4Se |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenoselenazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N4c5ccccc5[Se]c5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C33H22N4Se/c1-3-11-23(12-4-1)31-34-32(24-13-5-2-6-14-24)36-33(35-31)25-19-21-26(22-20-25)37-27-15-7-9-17-29(27)38-30-18-10-8-16-28(30)37/h1-22H |
| InChIKey | VGCIUYJUXKVYCR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|