C21H32FNOSi — CID 153438478
(2R)-2-benzyl-N-fluoro-5-tri(propan-2-yl)silylpent-4-ynamide (PubChem CID 153438478) has the molecular formula C21H32FNOSi and a molecular weight of 361.58 g/mol. Its IUPAC name is (2R)-2-benzyl-N-fluoro-5-tri(propan-2-yl)silylpent-4-ynamide.
| Compound Name | (2R)-2-benzyl-N-fluoro-5-tri(propan-2-yl)silylpent-4-ynamide |
|---|---|
| PubChem CID | 153438478 |
| Molecular Formula | C21H32FNOSi |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (2R)-2-benzyl-N-fluoro-5-tri(propan-2-yl)silylpent-4-ynamide |
| SMILES | CC(C)[Si](C#CC[C@@H](Cc1ccccc1)C(=O)NF)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H32FNOSi/c1-16(2)25(17(3)4,18(5)6)14-10-13-20(21(24)23-22)15-19-11-8-7-9-12-19/h7-9,11-12,16-18,20H,13,15H2,1-6H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | DNTZLOJCKMLOSN-FQEVSTJZSA-N |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|