C51H50F6O9 — CID 153454730
1,5-bis[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-6-yl]pentan-3-yloxymethyl prop-2-enoate (PubChem CID 153454730) has the molecular formula C51H50F6O9 and a molecular weight of 920.94 g/mol. Its IUPAC name is 1,5-bis[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-6-yl]pentan-3-yloxymethyl prop-2-enoate.
| Compound Name | 1,5-bis[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-6-yl]pentan-3-yloxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 153454730 |
| Molecular Formula | C51H50F6O9 |
| Molecular Weight | 920.94 g/mol |
| Exact Mass | 920.34 |
| IUPAC Name | 1,5-bis[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-6-yl]pentan-3-yloxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC(CCc1ccc2oc(=O)c(-c3ccc(CCCCC)cc3OC(F)(F)F)cc2c1)CCc1ccc2oc(=O)c(-c3ccc(CCCCC)cc3OC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C51H50F6O9/c1-4-7-9-11-32-15-21-39(45(27-32)65-50(52,53)54)41-29-36-25-34(17-23-43(36)63-48(41)59)13-19-38(61-31-62-47(58)6-3)20-14-35-18-24-44-37(26-35)30-42(49(60)64-44)40-22-16-33(12-10-8-5-2)28-46(40)66-51(55,56)57/h6,15-18,21-30,38H,3-5,7-14,19-20,31H2,1-2H3 |
| InChIKey | XWLZHXPNYXYMLF-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.94 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|