C55H62F2O9S2 — CID 153454738
[7-[1,3-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 153454738) has the molecular formula C55H62F2O9S2 and a molecular weight of 969.22 g/mol. Its IUPAC name is [7-[1,3-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[1,3-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 153454738 |
| Molecular Formula | C55H62F2O9S2 |
| Molecular Weight | 969.22 g/mol |
| Exact Mass | 968.38 |
| IUPAC Name | [7-[1,3-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]propan-2-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOC(COc1ccc2cc(-c3ccc(CCCCC)cc3OC)c(=O)sc2c1)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)c(=O)sc2c1 |
| InChI | InChI=1S/C55H62F2O9S2/c1-6-9-11-15-37-17-23-44(48(29-37)61-4)46-31-39-19-21-41(33-50(39)67-53(46)59)65-35-43(63-27-13-25-55(56,57)26-14-28-64-52(58)8-3)36-66-42-22-20-40-32-47(54(60)68-51(40)34-42)45-24-18-38(16-12-10-7-2)30-49(45)62-5/h8,17-24,29-34,43H,3,6-7,9-16,25-28,35-36H2,1-2,4-5H3 |
| InChIKey | SPVOPIBOPYCODA-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.22 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|