C46H40F6O9S2 — CID 153454758
[5-[1,5-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate (PubChem CID 153454758) has the molecular formula C46H40F6O9S2 and a molecular weight of 914.94 g/mol. Its IUPAC name is [5-[1,5-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[1,5-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153454758 |
| Molecular Formula | C46H40F6O9S2 |
| Molecular Weight | 914.94 g/mol |
| Exact Mass | 914.20 |
| IUPAC Name | [5-[1,5-bis[[3-(2-methoxyphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)COC(CCOc1ccc2cc(-c3ccccc3OC)c(=O)sc2c1)CCOc1ccc2cc(-c3ccccc3OC)c(=O)sc2c1 |
| InChI | InChI=1S/C46H40F6O9S2/c1-27(2)41(53)61-26-45(49,50)46(51,52)44(47,48)25-60-30(17-19-58-31-15-13-28-21-35(42(54)62-39(28)23-31)33-9-5-7-11-37(33)56-3)18-20-59-32-16-14-29-22-36(43(55)63-40(29)24-32)34-10-6-8-12-38(34)57-4/h5-16,21-24,30H,1,17-20,25-26H2,2-4H3 |
| InChIKey | OXLYARIFNGLJIN-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.94 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|