C57H66F2O9S2 — CID 153454747
[7-[1,5-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-4,4-difluoroheptyl] prop-2-enoate (PubChem CID 153454747) has the molecular formula C57H66F2O9S2 and a molecular weight of 997.28 g/mol. Its IUPAC name is [7-[1,5-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-4,4-difluoroheptyl] prop-2-enoate.
| Compound Name | [7-[1,5-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 153454747 |
| Molecular Formula | C57H66F2O9S2 |
| Molecular Weight | 997.28 g/mol |
| Exact Mass | 996.41 |
| IUPAC Name | [7-[1,5-bis[[3-(2-methoxy-4-pentylphenyl)-2-oxothiochromen-7-yl]oxy]pentan-3-yloxy]-4,4-difluoroheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOC(CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC)c(=O)sc2c1)CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC)c(=O)sc2c1 |
| InChI | InChI=1S/C57H66F2O9S2/c1-6-9-11-15-39-17-23-46(50(33-39)63-4)48-35-41-19-21-44(37-52(41)69-55(48)61)66-31-25-43(65-29-13-27-57(58,59)28-14-30-68-54(60)8-3)26-32-67-45-22-20-42-36-49(56(62)70-53(42)38-45)47-24-18-40(16-12-10-7-2)34-51(47)64-5/h8,17-24,33-38,43H,3,6-7,9-16,25-32H2,1-2,4-5H3 |
| InChIKey | TTWZLAPONGQHCQ-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.28 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|