C23H24BN4O2 — CID 153455211
CID 153455211 (PubChem CID 153455211) has the molecular formula C23H24BN4O2 and a molecular weight of 399.28 g/mol.
| Compound Name | CID 153455211 |
|---|---|
| PubChem CID | 153455211 |
| Molecular Formula | C23H24BN4O2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | — |
| SMILES | COc1cccc(Nc2cc(-c3ccccc3)nc(C3CCCN([B]C=O)C3)n2)c1 |
| InChI | InChI=1S/C23H24BN4O2/c1-30-20-11-5-10-19(13-20)25-22-14-21(17-7-3-2-4-8-17)26-23(27-22)18-9-6-12-28(15-18)24-16-29/h2-5,7-8,10-11,13-14,16,18H,6,9,12,15H2,1H3,(H,25,26,27) |
| InChIKey | TZTKIOPRHPRYET-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|